C19H29N5 — CID 10616216
6-methyl-2-N,2-N-dipropyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 10616216) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 6-methyl-2-N,2-N-dipropyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-methyl-2-N,2-N-dipropyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10616216 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 6-methyl-2-N,2-N-dipropyl-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCN(CCC)c1nc(C)nc(Nc2c(C)cc(C)cc2C)n1 |
| InChI | InChI=1S/C19H29N5/c1-7-9-24(10-8-2)19-21-16(6)20-18(23-19)22-17-14(4)11-13(3)12-15(17)5/h11-12H,7-10H2,1-6H3,(H,20,21,22,23) |
| InChIKey | NNXKPIFUBGDIBN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |