C14H21NO4S — CID 106162362
2-[2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]ethoxy]benzoic acid (PubChem CID 106162362) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-[2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]ethoxy]benzoic acid.
| Compound Name | 2-[2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 106162362 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]ethoxy]benzoic acid |
| SMILES | CSC(CO)C(C)NCCOc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H21NO4S/c1-10(13(9-16)20-2)15-7-8-19-12-6-4-3-5-11(12)14(17)18/h3-6,10,13,15-16H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | GDUGCCGDONKWQE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|