C10H19NO3S — CID 106162370
4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-3-methylbut-2-enoic acid (PubChem CID 106162370) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-3-methylbut-2-enoic acid.
| Compound Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 106162370 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-3-methylbut-2-enoic acid |
| SMILES | CSC(CO)C(C)NCC(C)=CC(=O)O |
| InChI | InChI=1S/C10H19NO3S/c1-7(4-10(13)14)5-11-8(2)9(6-12)15-3/h4,8-9,11-12H,5-6H2,1-3H3,(H,13,14) |
| InChIKey | BJKFOBDHBKZWLR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|