About cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate
cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate (PubChem CID 10616286) has the molecular formula C17H32O4Si
and a molecular weight of 328.53 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate |
| PubChem CID | 10616286 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)[C@]1(C(=O)OC)C[C@@H]1OCCCC |
| InChI | InChI=1S/C17H32O4Si/c1-9-10-11-20-14-12-17(14,15(18)19-6)13(2)21-22(7,8)16(3,4)5/h14H,2,9-12H2,1,3-8H3/t14-,17+/m0/s1 |
| InChIKey | NNEJTUDZIFCQQN-WMLDXEAASA-N |
| XLogP | 4.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate?
The IUPAC name of cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate (CID 10616286) is cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate is C=C(O[Si](C)(C)C(C)(C)C)[C@]1(C(=O)OC)C[C@@H]1OCCCC.
What is the InChIKey of cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate?
The InChIKey is NNEJTUDZIFCQQN-WMLDXEAASA-N. The full InChI is InChI=1S/C17H32O4Si/c1-9-10-11-20-14-12-17(14,15(18)19-6)13(2)21-22(7,8)16(3,4)5/h14H,2,9-12H2,1,3-8H3/t14-,17+/m0/s1.
What are the key properties of cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate?
cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate has a molecular weight of 328.53 g/mol, XLogP of 4.27, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,2S)-2-butoxy-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 10616286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).