C12H21BrN4OS — CID 106163553
3-[[5-bromo-6-(propylamino)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol (PubChem CID 106163553) has the molecular formula C12H21BrN4OS and a molecular weight of 349.30 g/mol. Its IUPAC name is 3-[[5-bromo-6-(propylamino)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[[5-bromo-6-(propylamino)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106163553 |
| Molecular Formula | C12H21BrN4OS |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-[[5-bromo-6-(propylamino)pyrimidin-4-yl]amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CCCNc1ncnc(NC(C)C(CO)SC)c1Br |
| InChI | InChI=1S/C12H21BrN4OS/c1-4-5-14-11-10(13)12(16-7-15-11)17-8(2)9(6-18)19-3/h7-9,18H,4-6H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | AQCYHTPNEKQFGC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |