C9H16N2O3 — CID 106164214
3-(2-cyclopropylpropanoylamino)-2-hydroxypropanamide (PubChem CID 106164214) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(2-cyclopropylpropanoylamino)-2-hydroxypropanamide.
| Compound Name | 3-(2-cyclopropylpropanoylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106164214 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(2-cyclopropylpropanoylamino)-2-hydroxypropanamide |
| SMILES | CC(C(=O)NCC(O)C(N)=O)C1CC1 |
| InChI | InChI=1S/C9H16N2O3/c1-5(6-2-3-6)9(14)11-4-7(12)8(10)13/h5-7,12H,2-4H2,1H3,(H2,10,13)(H,11,14) |
| InChIKey | IHHNLWOEDXNOFN-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |