C18H18O4S — CID 10616426
S-methyl (1S,9S,12S,16S)-9-methoxy-8-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,13-tetraene-1-carbothioate (PubChem CID 10616426) has the molecular formula C18H18O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is S-methyl (1S,9S,12S,16S)-9-methoxy-8-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,13-tetraene-1-carbothioate.
| Compound Name | S-methyl (1S,9S,12S,16S)-9-methoxy-8-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,13-tetraene-1-carbothioate |
|---|---|
| PubChem CID | 10616426 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | S-methyl (1S,9S,12S,16S)-9-methoxy-8-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,13-tetraene-1-carbothioate |
| SMILES | CO[C@@]12OC[C@H]3C=CC[C@@](C(=O)SC)(c4ccccc4C1=O)[C@H]32 |
| InChI | InChI=1S/C18H18O4S/c1-21-18-14-11(10-22-18)6-5-9-17(14,16(20)23-2)13-8-4-3-7-12(13)15(18)19/h3-8,11,14H,9-10H2,1-2H3/t11-,14+,17-,18+/m1/s1 |
| InChIKey | QFAMNBXQBBJTLQ-DKCMENCQSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|