About thieno[3,4-a]quinolizin-6-ium
thieno[3,4-a]quinolizin-6-ium (PubChem CID 10616469) has the molecular formula C11H8NS+
and a molecular weight of 186.26 g/mol. Its IUPAC name is thieno[3,4-a]quinolizin-6-ium.
Molecular Properties
| Compound Name | thieno[3,4-a]quinolizin-6-ium |
| PubChem CID | 10616469 |
| Molecular Formula | C11H8NS+ |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | thieno[3,4-a]quinolizin-6-ium |
| SMILES | c1cc[n+]2ccc3cscc3c2c1 |
| InChI | InChI=1S/C11H8NS/c1-2-5-12-6-4-9-7-13-8-10(9)11(12)3-1/h1-8H/q+1 |
| InChIKey | RCPLRHXASFGZER-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,4-a]quinolizin-6-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,4-a]quinolizin-6-ium?
The IUPAC name of thieno[3,4-a]quinolizin-6-ium (CID 10616469) is thieno[3,4-a]quinolizin-6-ium.
What is the SMILES notation for thieno[3,4-a]quinolizin-6-ium?
The canonical SMILES for thieno[3,4-a]quinolizin-6-ium is c1cc[n+]2ccc3cscc3c2c1.
What is the InChIKey of thieno[3,4-a]quinolizin-6-ium?
The InChIKey is RCPLRHXASFGZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8NS/c1-2-5-12-6-4-9-7-13-8-10(9)11(12)3-1/h1-8H/q+1.
What are the key properties of thieno[3,4-a]quinolizin-6-ium?
thieno[3,4-a]quinolizin-6-ium has a molecular weight of 186.26 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,4-a]quinolizin-6-ium is sourced from PubChem (CID 10616469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).