C19H25NO4 — CID 10616501
(2E,4E,6S)-N-[(1R,6S)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-2,4,6-trimethyldeca-2,4-dienamide (PubChem CID 10616501) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2E,4E,6S)-N-[(1R,6S)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-2,4,6-trimethyldeca-2,4-dienamide.
| Compound Name | (2E,4E,6S)-N-[(1R,6S)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-2,4,6-trimethyldeca-2,4-dienamide |
|---|---|
| PubChem CID | 10616501 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (2E,4E,6S)-N-[(1R,6S)-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]-2,4,6-trimethyldeca-2,4-dienamide |
| SMILES | CCCC[C@H](C)/C=C(C)/C=C(\C)C(=O)NC1=CC(=O)[C@H]2O[C@H]2C1=O |
| InChI | InChI=1S/C19H25NO4/c1-5-6-7-11(2)8-12(3)9-13(4)19(23)20-14-10-15(21)17-18(24-17)16(14)22/h8-11,17-18H,5-7H2,1-4H3,(H,20,23)/b12-8+,13-9+/t11-,17+,18-/m0/s1 |
| InChIKey | ODNRJYKJJALIDG-YQFFCSARSA-N |
| XLogP | 2.62 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|