C13H18ClNO3SSi — CID 10616535
(2S,3R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-4-oxoazetidine-1-sulfonyl chloride (PubChem CID 10616535) has the molecular formula C13H18ClNO3SSi and a molecular weight of 331.90 g/mol. Its IUPAC name is (2S,3R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-4-oxoazetidine-1-sulfonyl chloride.
| Compound Name | (2S,3R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-4-oxoazetidine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 10616535 |
| Molecular Formula | C13H18ClNO3SSi |
| Molecular Weight | 331.90 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (2S,3R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-4-oxoazetidine-1-sulfonyl chloride |
| SMILES | C[C@H]1C(=O)N(S(=O)(=O)Cl)[C@@H]1C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H18ClNO3SSi/c1-10-12(15(13(10)16)19(14,17)18)9-20(2,3)11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3/t10-,12-/m1/s1 |
| InChIKey | SGROUVBEFINJQK-ZYHUDNBSSA-N |
| XLogP | 1.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.90 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|