About 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide
5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide (PubChem CID 106165569) has the molecular formula C7H12F2N4O3S
and a molecular weight of 270.26 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide |
| PubChem CID | 106165569 |
| Molecular Formula | C7H12F2N4O3S |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(N)c1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C7H12F2N4O3S/c1-13-4-11-5(10)6(13)17(15,16)12-2-7(8,9)3-14/h4,12,14H,2-3,10H2,1H3 |
| InChIKey | CJUCTERDWNAFOT-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide?
The IUPAC name of 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide (CID 106165569) is 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide.
What is the SMILES notation for 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide?
The canonical SMILES for 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide is Cn1cnc(N)c1S(=O)(=O)NCC(F)(F)CO.
What is the InChIKey of 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide?
The InChIKey is CJUCTERDWNAFOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N4O3S/c1-13-4-11-5(10)6(13)17(15,16)12-2-7(8,9)3-14/h4,12,14H,2-3,10H2,1H3.
What are the key properties of 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide?
5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide has a molecular weight of 270.26 g/mol, XLogP of -1.09, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylimidazole-4-sulfonamide is sourced from PubChem (CID 106165569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).