About 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole
1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole (PubChem CID 10616589) has the molecular formula C16H16N2O2S2
and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole.
Molecular Properties
| Compound Name | 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole |
| PubChem CID | 10616589 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole |
| SMILES | CCCCn1c(-c2cccs2)cc([N+](=O)[O-])c1-c1cccs1 |
| InChI | InChI=1S/C16H16N2O2S2/c1-2-3-8-17-12(14-6-4-9-21-14)11-13(18(19)20)16(17)15-7-5-10-22-15/h4-7,9-11H,2-3,8H2,1H3 |
| InChIKey | IRZNURSMOCKKFI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole?
The IUPAC name of 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole (CID 10616589) is 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole.
What is the SMILES notation for 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole?
The canonical SMILES for 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole is CCCCn1c(-c2cccs2)cc([N+](=O)[O-])c1-c1cccs1.
What is the InChIKey of 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole?
The InChIKey is IRZNURSMOCKKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S2/c1-2-3-8-17-12(14-6-4-9-21-14)11-13(18(19)20)16(17)15-7-5-10-22-15/h4-7,9-11H,2-3,8H2,1H3.
What are the key properties of 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole?
1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole has a molecular weight of 332.45 g/mol, XLogP of 5.65, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-nitro-2,5-dithiophen-2-ylpyrrole is sourced from PubChem (CID 10616589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).