C18H27NO3Si — CID 10616670
[(3S,4S,5Z)-4-methyl-5-trimethylsilyloxyhepta-1,5-dien-3-yl] N-phenylcarbamate (PubChem CID 10616670) has the molecular formula C18H27NO3Si and a molecular weight of 333.50 g/mol. Its IUPAC name is [(3S,4S,5Z)-4-methyl-5-trimethylsilyloxyhepta-1,5-dien-3-yl] N-phenylcarbamate.
| Compound Name | [(3S,4S,5Z)-4-methyl-5-trimethylsilyloxyhepta-1,5-dien-3-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 10616670 |
| Molecular Formula | C18H27NO3Si |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | [(3S,4S,5Z)-4-methyl-5-trimethylsilyloxyhepta-1,5-dien-3-yl] N-phenylcarbamate |
| SMILES | C=C[C@H](OC(=O)Nc1ccccc1)[C@H](C)/C(=C/C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H27NO3Si/c1-7-16(14(3)17(8-2)22-23(4,5)6)21-18(20)19-15-12-10-9-11-13-15/h7-14,16H,1H2,2-6H3,(H,19,20)/b17-8-/t14-,16-/m0/s1 |
| InChIKey | JBLLIFBSMKBUIU-SGHSCFDHSA-N |
| XLogP | 5.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|