About [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate
[(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 10616671) has the molecular formula C19H31NO2Si
and a molecular weight of 333.55 g/mol. Its IUPAC name is [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate |
| PubChem CID | 10616671 |
| Molecular Formula | C19H31NO2Si |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O[C@@H](/C=C/c1ccccc1)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C19H31NO2Si/c1-15(2)20(16(3)4)19(21)22-18(23(5,6)7)14-13-17-11-9-8-10-12-17/h8-16,18H,1-7H3/b14-13+/t18-/m1/s1 |
| InChIKey | QOPWZGKVOWWMNH-KAUXGEHWSA-N |
| XLogP | 5.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate?
The IUPAC name of [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate (CID 10616671) is [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate?
The canonical SMILES for [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate is CC(C)N(C(=O)O[C@@H](/C=C/c1ccccc1)[Si](C)(C)C)C(C)C.
What is the InChIKey of [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate?
The InChIKey is QOPWZGKVOWWMNH-KAUXGEHWSA-N. The full InChI is InChI=1S/C19H31NO2Si/c1-15(2)20(16(3)4)19(21)22-18(23(5,6)7)14-13-17-11-9-8-10-12-17/h8-16,18H,1-7H3/b14-13+/t18-/m1/s1.
What are the key properties of [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate?
[(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate has a molecular weight of 333.55 g/mol, XLogP of 5.20, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,1R)-3-phenyl-1-trimethylsilylprop-2-enyl] N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 10616671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).