C13H15Cl2FN2S — CID 106166821
N-(3,5-dichloro-4-fluorophenyl)-4-ethyl-4-methyl-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 106166821) has the molecular formula C13H15Cl2FN2S and a molecular weight of 321.25 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-4-ethyl-4-methyl-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-4-ethyl-4-methyl-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 106166821 |
| Molecular Formula | C13H15Cl2FN2S |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-4-ethyl-4-methyl-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | CCC1(C)CCSC(Nc2cc(Cl)c(F)c(Cl)c2)=N1 |
| InChI | InChI=1S/C13H15Cl2FN2S/c1-3-13(2)4-5-19-12(18-13)17-8-6-9(14)11(16)10(15)7-8/h6-7H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | NMQQOHIZWAPDGG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|