C12H25NO2 — CID 106166843
N-(1-hydroxy-3-methylpentan-3-yl)-2,2-dimethylbutanamide (PubChem CID 106166843) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylpentan-3-yl)-2,2-dimethylbutanamide.
| Compound Name | N-(1-hydroxy-3-methylpentan-3-yl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 106166843 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-(1-hydroxy-3-methylpentan-3-yl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(CCO)NC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H25NO2/c1-6-11(3,4)10(15)13-12(5,7-2)8-9-14/h14H,6-9H2,1-5H3,(H,13,15) |
| InChIKey | RUKUEOQVRVFFIS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |