C15H11FN2O4S — CID 10616695
3-(4-fluorophenyl)sulfonyl-1-phenylimidazolidine-2,4-dione (PubChem CID 10616695) has the molecular formula C15H11FN2O4S and a molecular weight of 334.33 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10616695 |
| Molecular Formula | C15H11FN2O4S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-1-phenylimidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccccc2)C(=O)N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11FN2O4S/c16-11-6-8-13(9-7-11)23(21,22)18-14(19)10-17(15(18)20)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | XUEHUCHMGFVLKC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|