About 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol
3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 106167606) has the molecular formula C10H12F2N4O
and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 106167606 |
| Molecular Formula | C10H12F2N4O |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | Nc1cc2cn[nH]c2cc1NCC(F)(F)CO |
| InChI | InChI=1S/C10H12F2N4O/c11-10(12,5-17)4-14-9-2-8-6(1-7(9)13)3-15-16-8/h1-3,14,17H,4-5,13H2,(H,15,16) |
| InChIKey | UHJZMJGFJLBTIC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol (CID 106167606) is 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol is Nc1cc2cn[nH]c2cc1NCC(F)(F)CO.
What is the InChIKey of 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol?
The InChIKey is UHJZMJGFJLBTIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N4O/c11-10(12,5-17)4-14-9-2-8-6(1-7(9)13)3-15-16-8/h1-3,14,17H,4-5,13H2,(H,15,16).
What are the key properties of 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol?
3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol has a molecular weight of 242.23 g/mol, XLogP of 1.18, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1H-indazol-6-yl)amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 106167606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).