C17H15F2NO2S — CID 10616776
4-[2-(3,4-difluorophenyl)cyclopenten-1-yl]benzenesulfonamide (PubChem CID 10616776) has the molecular formula C17H15F2NO2S and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenyl)cyclopenten-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-(3,4-difluorophenyl)cyclopenten-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10616776 |
| Molecular Formula | C17H15F2NO2S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-[2-(3,4-difluorophenyl)cyclopenten-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(F)c(F)c3)CCC2)cc1 |
| InChI | InChI=1S/C17H15F2NO2S/c18-16-9-6-12(10-17(16)19)15-3-1-2-14(15)11-4-7-13(8-5-11)23(20,21)22/h4-10H,1-3H2,(H2,20,21,22) |
| InChIKey | PZDSRZQDLSVQIG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|