C12H24ClNO — CID 106168655
N-(1-chloro-3-methylpentan-3-yl)-3-methylpentanamide (PubChem CID 106168655) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is N-(1-chloro-3-methylpentan-3-yl)-3-methylpentanamide.
| Compound Name | N-(1-chloro-3-methylpentan-3-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 106168655 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-(1-chloro-3-methylpentan-3-yl)-3-methylpentanamide |
| SMILES | CCC(C)CC(=O)NC(C)(CC)CCCl |
| InChI | InChI=1S/C12H24ClNO/c1-5-10(3)9-11(15)14-12(4,6-2)7-8-13/h10H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | RBFXNKZXEYSNND-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|