About 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid
5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid (PubChem CID 106168679) has the molecular formula C11H13F2NO6S
and a molecular weight of 325.29 g/mol. Its IUPAC name is 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid |
| PubChem CID | 106168679 |
| Molecular Formula | C11H13F2NO6S |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid |
| SMILES | Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C11H13F2NO6S/c1-6-2-8(16)7(10(17)18)3-9(6)21(19,20)14-4-11(12,13)5-15/h2-3,14-16H,4-5H2,1H3,(H,17,18) |
| InChIKey | RNPHOKJLKXZHRS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid?
The IUPAC name of 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid (CID 106168679) is 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid.
What is the SMILES notation for 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid?
The canonical SMILES for 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid is Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)NCC(F)(F)CO.
What is the InChIKey of 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid?
The InChIKey is RNPHOKJLKXZHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO6S/c1-6-2-8(16)7(10(17)18)3-9(6)21(19,20)14-4-11(12,13)5-15/h2-3,14-16H,4-5H2,1H3,(H,17,18).
What are the key properties of 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid?
5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid has a molecular weight of 325.29 g/mol, XLogP of 0.30, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-hydroxy-4-methylbenzoic acid is sourced from PubChem (CID 106168679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).