About N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide
N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide (PubChem CID 106168971) has the molecular formula C11H20BrNO3
and a molecular weight of 294.19 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide |
| PubChem CID | 106168971 |
| Molecular Formula | C11H20BrNO3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide |
| SMILES | CCC(C)(CCBr)NC(=O)C1COCCO1 |
| InChI | InChI=1S/C11H20BrNO3/c1-3-11(2,4-5-12)13-10(14)9-8-15-6-7-16-9/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | HOKRJSNTLSJNSC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide?
The IUPAC name of N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide (CID 106168971) is N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide is CCC(C)(CCBr)NC(=O)C1COCCO1.
What is the InChIKey of N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide?
The InChIKey is HOKRJSNTLSJNSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrNO3/c1-3-11(2,4-5-12)13-10(14)9-8-15-6-7-16-9/h9H,3-8H2,1-2H3,(H,13,14).
What are the key properties of N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide?
N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide has a molecular weight of 294.19 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-bromo-3-methylpentan-3-yl)-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 106168971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).