C12H22BrNO2 — CID 106169351
N-(1-bromo-3-methylpentan-3-yl)oxane-4-carboxamide (PubChem CID 106169351) has the molecular formula C12H22BrNO2 and a molecular weight of 292.22 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)oxane-4-carboxamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 106169351 |
| Molecular Formula | C12H22BrNO2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)oxane-4-carboxamide |
| SMILES | CCC(C)(CCBr)NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C12H22BrNO2/c1-3-12(2,6-7-13)14-11(15)10-4-8-16-9-5-10/h10H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | WRIWWYCXDPPYSO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|