C13H18N6O5 — CID 10616958
[(1R,2R,5S,6S)-2-(acetyloxymethyl)-5-azido-3-(azidomethyl)-6-hydroxycyclohex-3-en-1-yl]methyl acetate (PubChem CID 10616958) has the molecular formula C13H18N6O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is [(1R,2R,5S,6S)-2-(acetyloxymethyl)-5-azido-3-(azidomethyl)-6-hydroxycyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1R,2R,5S,6S)-2-(acetyloxymethyl)-5-azido-3-(azidomethyl)-6-hydroxycyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10616958 |
| Molecular Formula | C13H18N6O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [(1R,2R,5S,6S)-2-(acetyloxymethyl)-5-azido-3-(azidomethyl)-6-hydroxycyclohex-3-en-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@H](O)[C@@H](N=[N+]=[N-])C=C(CN=[N+]=[N-])[C@@H]1COC(C)=O |
| InChI | InChI=1S/C13H18N6O5/c1-7(20)23-5-10-9(4-16-18-14)3-12(17-19-15)13(22)11(10)6-24-8(2)21/h3,10-13,22H,4-6H2,1-2H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | DKGODNZWQWKFPT-CYDGBPFRSA-N |
| XLogP | 1.64 |
| TPSA | 170.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|