C11H25NO4S — CID 106169938
N-(1-hydroxy-3-methylpentan-3-yl)-2-propan-2-yloxyethanesulfonamide (PubChem CID 106169938) has the molecular formula C11H25NO4S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylpentan-3-yl)-2-propan-2-yloxyethanesulfonamide.
| Compound Name | N-(1-hydroxy-3-methylpentan-3-yl)-2-propan-2-yloxyethanesulfonamide |
|---|---|
| PubChem CID | 106169938 |
| Molecular Formula | C11H25NO4S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(1-hydroxy-3-methylpentan-3-yl)-2-propan-2-yloxyethanesulfonamide |
| SMILES | CCC(C)(CCO)NS(=O)(=O)CCOC(C)C |
| InChI | InChI=1S/C11H25NO4S/c1-5-11(4,6-7-13)12-17(14,15)9-8-16-10(2)3/h10,12-13H,5-9H2,1-4H3 |
| InChIKey | LQTUISKCAIEZKW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |