C10H19BrF3NO2S — CID 106170056
N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 106170056) has the molecular formula C10H19BrF3NO2S and a molecular weight of 354.23 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 106170056 |
| Molecular Formula | C10H19BrF3NO2S |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CCC(C)(CCBr)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H19BrF3NO2S/c1-3-9(2,6-7-11)15-18(16,17)8-4-5-10(12,13)14/h15H,3-8H2,1-2H3 |
| InChIKey | JSHBMKKURUOXCZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|