C14H21ClFNO2S — CID 106170161
N-(1-chloro-3-methylpentan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 106170161) has the molecular formula C14H21ClFNO2S and a molecular weight of 321.85 g/mol. Its IUPAC name is N-(1-chloro-3-methylpentan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-(1-chloro-3-methylpentan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106170161 |
| Molecular Formula | C14H21ClFNO2S |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(1-chloro-3-methylpentan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | CCC(C)(CCCl)NS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C14H21ClFNO2S/c1-5-14(4,6-7-15)17-20(18,19)13-10(2)8-12(16)9-11(13)3/h8-9,17H,5-7H2,1-4H3 |
| InChIKey | GJAXNCDROOWROB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|