C10H12Cl2N2O2 — CID 106170892
3-[(2,6-dichlorophenyl)methylamino]-2-hydroxypropanamide (PubChem CID 106170892) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(2,6-dichlorophenyl)methylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106170892 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methylamino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O2/c11-7-2-1-3-8(12)6(7)4-14-5-9(15)10(13)16/h1-3,9,14-15H,4-5H2,(H2,13,16) |
| InChIKey | HCOSBPORQMKEDB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |