C14H21N3O2 — CID 106170985
2-hydroxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]propanamide (PubChem CID 106170985) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-hydroxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]propanamide.
| Compound Name | 2-hydroxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 106170985 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-hydroxy-3-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]propanamide |
| SMILES | CN1CCCc2cc(CNCC(O)C(N)=O)ccc21 |
| InChI | InChI=1S/C14H21N3O2/c1-17-6-2-3-11-7-10(4-5-12(11)17)8-16-9-13(18)14(15)19/h4-5,7,13,16,18H,2-3,6,8-9H2,1H3,(H2,15,19) |
| InChIKey | PIDIEGJIHMBCBO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|