C10H17N3O2 — CID 106171023
3-[(1-ethylpyrrol-3-yl)methylamino]-2-hydroxypropanamide (PubChem CID 106171023) has the molecular formula C10H17N3O2 and a molecular weight of 211.27 g/mol. Its IUPAC name is 3-[(1-ethylpyrrol-3-yl)methylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(1-ethylpyrrol-3-yl)methylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106171023 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-[(1-ethylpyrrol-3-yl)methylamino]-2-hydroxypropanamide |
| SMILES | CCn1ccc(CNCC(O)C(N)=O)c1 |
| InChI | InChI=1S/C10H17N3O2/c1-2-13-4-3-8(7-13)5-12-6-9(14)10(11)15/h3-4,7,9,12,14H,2,5-6H2,1H3,(H2,11,15) |
| InChIKey | ZOFQZRUDNHVBFW-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |