About 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide
3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide (PubChem CID 106171661) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide.
Molecular Properties
| Compound Name | 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide |
| PubChem CID | 106171661 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide |
| SMILES | CC1CC(NCC(O)C(N)=O)CN1C |
| InChI | InChI=1S/C9H19N3O2/c1-6-3-7(5-12(6)2)11-4-8(13)9(10)14/h6-8,11,13H,3-5H2,1-2H3,(H2,10,14) |
| InChIKey | SNIJRVHQMNREAD-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide?
The IUPAC name of 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide (CID 106171661) is 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide.
What is the SMILES notation for 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide?
The canonical SMILES for 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide is CC1CC(NCC(O)C(N)=O)CN1C.
What is the InChIKey of 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide?
The InChIKey is SNIJRVHQMNREAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2/c1-6-3-7(5-12(6)2)11-4-8(13)9(10)14/h6-8,11,13H,3-5H2,1-2H3,(H2,10,14).
What are the key properties of 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide?
3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide has a molecular weight of 201.27 g/mol, XLogP of -1.49, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-2-hydroxypropanamide is sourced from PubChem (CID 106171661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).