About 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile
3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile (PubChem CID 106172250) has the molecular formula C10H9ClF2N2O
and a molecular weight of 246.64 g/mol. Its IUPAC name is 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile |
| PubChem CID | 106172250 |
| Molecular Formula | C10H9ClF2N2O |
| Molecular Weight | 246.64 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile |
| SMILES | N#Cc1ccc(NCC(F)(F)CO)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClF2N2O/c11-8-3-7(4-14)1-2-9(8)15-5-10(12,13)6-16/h1-3,15-16H,5-6H2 |
| InChIKey | KVOZVMXNPGPQSR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile?
The IUPAC name of 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile (CID 106172250) is 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile.
What is the SMILES notation for 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile?
The canonical SMILES for 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile is N#Cc1ccc(NCC(F)(F)CO)c(Cl)c1.
What is the InChIKey of 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile?
The InChIKey is KVOZVMXNPGPQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF2N2O/c11-8-3-7(4-14)1-2-9(8)15-5-10(12,13)6-16/h1-3,15-16H,5-6H2.
What are the key properties of 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile?
3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile has a molecular weight of 246.64 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(2,2-difluoro-3-hydroxypropyl)amino]benzonitrile is sourced from PubChem (CID 106172250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).