C9H13F2NO3 — CID 106172524
1-(2,2-difluoro-3-hydroxypropyl)-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 106172524) has the molecular formula C9H13F2NO3 and a molecular weight of 221.20 g/mol. Its IUPAC name is 1-(2,2-difluoro-3-hydroxypropyl)-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-(2,2-difluoro-3-hydroxypropyl)-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106172524 |
| Molecular Formula | C9H13F2NO3 |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-(2,2-difluoro-3-hydroxypropyl)-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(CC(F)(F)CO)C(=O)C1C |
| InChI | InChI=1S/C9H13F2NO3/c1-5-6(2)8(15)12(7(5)14)3-9(10,11)4-13/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | GQPPRUKKIMCASF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|