About 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide
4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 106174581) has the molecular formula C11H16F2N4O2S
and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 106174581 |
| Molecular Formula | C11H16F2N4O2S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(N2CCCC2)sc1C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C11H16F2N4O2S/c12-11(13,6-18)5-15-9(19)7-8(14)16-10(20-7)17-3-1-2-4-17/h18H,1-6,14H2,(H,15,19) |
| InChIKey | DSRXAPPGHBITGP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide (CID 106174581) is 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide is Nc1nc(N2CCCC2)sc1C(=O)NCC(F)(F)CO.
What is the InChIKey of 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide?
The InChIKey is DSRXAPPGHBITGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N4O2S/c12-11(13,6-18)5-15-9(19)7-8(14)16-10(20-7)17-3-1-2-4-17/h18H,1-6,14H2,(H,15,19).
What are the key properties of 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide?
4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide has a molecular weight of 306.34 g/mol, XLogP of 0.68, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 106174581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).