C17H32N2O — CID 106175448
4-(2-aminoethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylhexanamide (PubChem CID 106175448) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylhexanamide.
| Compound Name | 4-(2-aminoethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 106175448 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 4-(2-aminoethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)C(CCN)CCC(=O)NCCC1=CCCC1 |
| InChI | InChI=1S/C17H32N2O/c1-17(2,3)15(10-12-18)8-9-16(20)19-13-11-14-6-4-5-7-14/h6,15H,4-5,7-13,18H2,1-3H3,(H,19,20) |
| InChIKey | VTFMSMWHGVZYOC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|