C9H19N3O3 — CID 106175532
N-(3-amino-2-hydroxy-3-oxopropyl)-2-(aminomethyl)pentanamide (PubChem CID 106175532) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-2-(aminomethyl)pentanamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(aminomethyl)pentanamide |
|---|---|
| PubChem CID | 106175532 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(aminomethyl)pentanamide |
| SMILES | CCCC(CN)C(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C9H19N3O3/c1-2-3-6(4-10)9(15)12-5-7(13)8(11)14/h6-7,13H,2-5,10H2,1H3,(H2,11,14)(H,12,15) |
| InChIKey | BIAJOZYMBVSVOR-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |