C8H15N3O3 — CID 106175640
3-[[2-(cyclopropylamino)acetyl]amino]-2-hydroxypropanamide (PubChem CID 106175640) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-[[2-(cyclopropylamino)acetyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[2-(cyclopropylamino)acetyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106175640 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 3-[[2-(cyclopropylamino)acetyl]amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC(=O)CNC1CC1 |
| InChI | InChI=1S/C8H15N3O3/c9-8(14)6(12)3-11-7(13)4-10-5-1-2-5/h5-6,10,12H,1-4H2,(H2,9,14)(H,11,13) |
| InChIKey | CVLSNMDYBQYJJQ-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |