About 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one
2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 106175986) has the molecular formula C12H13F2N3O2
and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 106175986 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCC(F)(F)CO)nc2ccccn12 |
| InChI | InChI=1S/C12H13F2N3O2/c13-12(14,8-18)7-15-6-9-5-11(19)17-4-2-1-3-10(17)16-9/h1-5,15,18H,6-8H2 |
| InChIKey | IXPXPMRHXFUUAJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one (CID 106175986) is 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one is O=c1cc(CNCC(F)(F)CO)nc2ccccn12.
What is the InChIKey of 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is IXPXPMRHXFUUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3O2/c13-12(14,8-18)7-15-6-9-5-11(19)17-4-2-1-3-10(17)16-9/h1-5,15,18H,6-8H2.
What are the key properties of 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one?
2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 269.25 g/mol, XLogP of 0.41, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 106175986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).