C15H32N2O2 — CID 106176028
4-(2-aminoethyl)-N-(1-hydroxy-3-methylpentan-3-yl)-5-methylhexanamide (PubChem CID 106176028) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(1-hydroxy-3-methylpentan-3-yl)-5-methylhexanamide.
| Compound Name | 4-(2-aminoethyl)-N-(1-hydroxy-3-methylpentan-3-yl)-5-methylhexanamide |
|---|---|
| PubChem CID | 106176028 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 4-(2-aminoethyl)-N-(1-hydroxy-3-methylpentan-3-yl)-5-methylhexanamide |
| SMILES | CCC(C)(CCO)NC(=O)CCC(CCN)C(C)C |
| InChI | InChI=1S/C15H32N2O2/c1-5-15(4,9-11-18)17-14(19)7-6-13(8-10-16)12(2)3/h12-13,18H,5-11,16H2,1-4H3,(H,17,19) |
| InChIKey | CVFIJJLSJMOTAI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |