C13H23F2NO2 — CID 106176373
2,2-difluoro-3-(1-oxaspiro[5.5]undecan-4-ylamino)propan-1-ol (PubChem CID 106176373) has the molecular formula C13H23F2NO2 and a molecular weight of 263.33 g/mol. Its IUPAC name is 2,2-difluoro-3-(1-oxaspiro[5.5]undecan-4-ylamino)propan-1-ol.
| Compound Name | 2,2-difluoro-3-(1-oxaspiro[5.5]undecan-4-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 106176373 |
| Molecular Formula | C13H23F2NO2 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2,2-difluoro-3-(1-oxaspiro[5.5]undecan-4-ylamino)propan-1-ol |
| SMILES | OCC(F)(F)CNC1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C13H23F2NO2/c14-13(15,10-17)9-16-11-4-7-18-12(8-11)5-2-1-3-6-12/h11,16-17H,1-10H2 |
| InChIKey | WJTMJTZPHGWTLS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |