C11H15F2N3O3 — CID 106176389
3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylamino]-2,2-difluoropropan-1-ol (PubChem CID 106176389) has the molecular formula C11H15F2N3O3 and a molecular weight of 275.25 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 106176389 |
| Molecular Formula | C11H15F2N3O3 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylamino]-2,2-difluoropropan-1-ol |
| SMILES | Cc1cnc(CNCC(F)(F)CO)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15F2N3O3/c1-7-3-15-9(8(2)10(7)16(18)19)4-14-5-11(12,13)6-17/h3,14,17H,4-6H2,1-2H3 |
| InChIKey | VCDGEWQXRBBWFA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|