About methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate
methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate (PubChem CID 10617654) has the molecular formula C18H21NO4S
and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate.
Molecular Properties
| Compound Name | methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate |
| PubChem CID | 10617654 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate |
| SMILES | CCOC(=O)/C=C1\NC(Cc2ccccc2)=C(C(=O)OC)C(C)S1 |
| InChI | InChI=1S/C18H21NO4S/c1-4-23-16(20)11-15-19-14(10-13-8-6-5-7-9-13)17(12(2)24-15)18(21)22-3/h5-9,11-12,19H,4,10H2,1-3H3/b15-11+ |
| InChIKey | OGIFWIVOIZNYOF-RVDMUPIBSA-N |
| XLogP | 2.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate?
The IUPAC name of methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate (CID 10617654) is methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate.
What is the SMILES notation for methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate?
The canonical SMILES for methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate is CCOC(=O)/C=C1\NC(Cc2ccccc2)=C(C(=O)OC)C(C)S1.
What is the InChIKey of methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate?
The InChIKey is OGIFWIVOIZNYOF-RVDMUPIBSA-N. The full InChI is InChI=1S/C18H21NO4S/c1-4-23-16(20)11-15-19-14(10-13-8-6-5-7-9-13)17(12(2)24-15)18(21)22-3/h5-9,11-12,19H,4,10H2,1-3H3/b15-11+.
What are the key properties of methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate?
methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate has a molecular weight of 347.44 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-4-benzyl-2-(2-ethoxy-2-oxoethylidene)-6-methyl-3,6-dihydro-1,3-thiazine-5-carboxylate is sourced from PubChem (CID 10617654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).