About 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile
5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile (PubChem CID 106176562) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile |
| PubChem CID | 106176562 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCNCC(F)(F)CO |
| InChI | InChI=1S/C10H18F2N2O/c1-9(2,6-13)4-3-5-14-7-10(11,12)8-15/h14-15H,3-5,7-8H2,1-2H3 |
| InChIKey | NIHYRKOXCAUQEJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile?
The IUPAC name of 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile (CID 106176562) is 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile is CC(C)(C#N)CCCNCC(F)(F)CO.
What is the InChIKey of 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile?
The InChIKey is NIHYRKOXCAUQEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-9(2,6-13)4-3-5-14-7-10(11,12)8-15/h14-15H,3-5,7-8H2,1-2H3.
What are the key properties of 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile?
5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile has a molecular weight of 220.26 g/mol, XLogP of 1.53, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-difluoro-3-hydroxypropyl)amino]-2,2-dimethylpentanenitrile is sourced from PubChem (CID 106176562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).