About 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol
3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol (PubChem CID 106176591) has the molecular formula C10H17F2N3O
and a molecular weight of 233.26 g/mol. Its IUPAC name is 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol |
| PubChem CID | 106176591 |
| Molecular Formula | C10H17F2N3O |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol |
| SMILES | CCn1nc(C)cc1CNCC(F)(F)CO |
| InChI | InChI=1S/C10H17F2N3O/c1-3-15-9(4-8(2)14-15)5-13-6-10(11,12)7-16/h4,13,16H,3,5-7H2,1-2H3 |
| InChIKey | KXRBONISDSEGPF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol (CID 106176591) is 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol is CCn1nc(C)cc1CNCC(F)(F)CO.
What is the InChIKey of 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol?
The InChIKey is KXRBONISDSEGPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N3O/c1-3-15-9(4-8(2)14-15)5-13-6-10(11,12)7-16/h4,13,16H,3,5-7H2,1-2H3.
What are the key properties of 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol?
3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol has a molecular weight of 233.26 g/mol, XLogP of 0.93, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 106176591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).