About N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide
N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide (PubChem CID 106176795) has the molecular formula C8H14F2N2O3
and a molecular weight of 224.21 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide |
| PubChem CID | 106176795 |
| Molecular Formula | C8H14F2N2O3 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)CO)C1COCCN1 |
| InChI | InChI=1S/C8H14F2N2O3/c9-8(10,5-13)4-12-7(14)6-3-15-2-1-11-6/h6,11,13H,1-5H2,(H,12,14) |
| InChIKey | WIMDLDJJHHUQIY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide?
The IUPAC name of N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide (CID 106176795) is N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide.
What is the SMILES notation for N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide?
The canonical SMILES for N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide is O=C(NCC(F)(F)CO)C1COCCN1.
What is the InChIKey of N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide?
The InChIKey is WIMDLDJJHHUQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O3/c9-8(10,5-13)4-12-7(14)6-3-15-2-1-11-6/h6,11,13H,1-5H2,(H,12,14).
What are the key properties of N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide?
N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide has a molecular weight of 224.21 g/mol, XLogP of -1.28, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoro-3-hydroxypropyl)morpholine-3-carboxamide is sourced from PubChem (CID 106176795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).