About 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol
3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol (PubChem CID 106176815) has the molecular formula C12H21F2NO3
and a molecular weight of 265.30 g/mol. Its IUPAC name is 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol |
| PubChem CID | 106176815 |
| Molecular Formula | C12H21F2NO3 |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol |
| SMILES | OCC(F)(F)CNC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C12H21F2NO3/c13-12(14,9-16)8-15-10-1-4-18-11(7-10)2-5-17-6-3-11/h10,15-16H,1-9H2 |
| InChIKey | FSPJYSVUBZJLCY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol?
The IUPAC name of 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol (CID 106176815) is 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol is OCC(F)(F)CNC1CCOC2(CCOCC2)C1.
What is the InChIKey of 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol?
The InChIKey is FSPJYSVUBZJLCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO3/c13-12(14,9-16)8-15-10-1-4-18-11(7-10)2-5-17-6-3-11/h10,15-16H,1-9H2.
What are the key properties of 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol?
3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol has a molecular weight of 265.30 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)-2,2-difluoropropan-1-ol is sourced from PubChem (CID 106176815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).