About 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one
4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one (PubChem CID 106176831) has the molecular formula C9H16F2N2O2
and a molecular weight of 222.23 g/mol. Its IUPAC name is 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one.
Molecular Properties
| Compound Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one |
| PubChem CID | 106176831 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one |
| SMILES | O=C1CC(NCC(F)(F)CO)CCCN1 |
| InChI | InChI=1S/C9H16F2N2O2/c10-9(11,6-14)5-13-7-2-1-3-12-8(15)4-7/h7,13-14H,1-6H2,(H,12,15) |
| InChIKey | SOBAYEICCBTUFU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one?
The IUPAC name of 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one (CID 106176831) is 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one.
What is the SMILES notation for 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one?
The canonical SMILES for 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one is O=C1CC(NCC(F)(F)CO)CCCN1.
What is the InChIKey of 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one?
The InChIKey is SOBAYEICCBTUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O2/c10-9(11,6-14)5-13-7-2-1-3-12-8(15)4-7/h7,13-14H,1-6H2,(H,12,15).
What are the key properties of 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one?
4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one has a molecular weight of 222.23 g/mol, XLogP of -0.13, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-difluoro-3-hydroxypropyl)amino]azepan-2-one is sourced from PubChem (CID 106176831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).