About (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide
(2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide (PubChem CID 106176901) has the molecular formula C8H16F2N2O2S
and a molecular weight of 242.29 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide |
| PubChem CID | 106176901 |
| Molecular Formula | C8H16F2N2O2S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C8H16F2N2O2S/c1-15-3-2-6(11)7(14)12-4-8(9,10)5-13/h6,13H,2-5,11H2,1H3,(H,12,14)/t6-/m0/s1 |
| InChIKey | YOAMPGXOKSAGHS-LURJTMIESA-N |
| XLogP | -0.19 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide?
The IUPAC name of (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide (CID 106176901) is (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide.
What is the SMILES notation for (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide?
The canonical SMILES for (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide is CSCC[C@H](N)C(=O)NCC(F)(F)CO.
What is the InChIKey of (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide?
The InChIKey is YOAMPGXOKSAGHS-LURJTMIESA-N. The full InChI is InChI=1S/C8H16F2N2O2S/c1-15-3-2-6(11)7(14)12-4-8(9,10)5-13/h6,13H,2-5,11H2,1H3,(H,12,14)/t6-/m0/s1.
What are the key properties of (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide?
(2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide has a molecular weight of 242.29 g/mol, XLogP of -0.19, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-methylsulfanylbutanamide is sourced from PubChem (CID 106176901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).