About 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol
3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol (PubChem CID 106176958) has the molecular formula C11H13Cl2F2NO2
and a molecular weight of 300.13 g/mol. Its IUPAC name is 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 106176958 |
| Molecular Formula | C11H13Cl2F2NO2 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol |
| SMILES | OCC(F)(F)CNCC(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl2F2NO2/c12-7-1-2-9(13)8(3-7)10(18)4-16-5-11(14,15)6-17/h1-3,10,16-18H,4-6H2 |
| InChIKey | HPTAZZFHTGRESY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol (CID 106176958) is 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol is OCC(F)(F)CNCC(O)c1cc(Cl)ccc1Cl.
What is the InChIKey of 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol?
The InChIKey is HPTAZZFHTGRESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2F2NO2/c12-7-1-2-9(13)8(3-7)10(18)4-16-5-11(14,15)6-17/h1-3,10,16-18H,4-6H2.
What are the key properties of 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol?
3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol has a molecular weight of 300.13 g/mol, XLogP of 2.24, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 106176958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).