C12H17F2N3O3 — CID 106177194
5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-N'-hydroxy-2-methoxybenzenecarboximidamide (PubChem CID 106177194) has the molecular formula C12H17F2N3O3 and a molecular weight of 289.28 g/mol. Its IUPAC name is 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-N'-hydroxy-2-methoxybenzenecarboximidamide.
| Compound Name | 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-N'-hydroxy-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106177194 |
| Molecular Formula | C12H17F2N3O3 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-N'-hydroxy-2-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(CNCC(F)(F)CO)cc1/C(N)=N/O |
| InChI | InChI=1S/C12H17F2N3O3/c1-20-10-3-2-8(4-9(10)11(15)17-19)5-16-6-12(13,14)7-18/h2-4,16,18-19H,5-7H2,1H3,(H2,15,17) |
| InChIKey | LMTNSVPAUUKJFD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|